Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Methyl-2-Propanyl [(3-Methylenecyclobutyl)Methyl]Carbamate |
|---|---|
| Synonyms | tert-butyl ((3-methylenecyclobutyl)methyl)carbamate |
| Molecular Structure | ![CAS#: 130369-08-3， 2-Methyl-2-Propanyl [(3-Methylenecyclobutyl)Methyl]Carbamate](/moreStructures/130369-08-3.gif) |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.27 |
| CAS Registry Number | 130369-08-3 |
| SMILES | CC(C)(C)OC(=O)NCC1CC(=C)C1 |
| InChI | rd-copy-button" onmouseover="ClipboardCopyInit(this, |
| Density | 0.991g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.499°C at 760 mmHg (Cal.) |
| Flash point | 124.651°C (Cal.) |
| Refractive index | 1.474 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl [(3-Methylenecyclobutyl)Methyl]Carbamate |