Online Database of Chemicals from Around the World
| Name | 3,4-Dichlorophenylcarbamodithioic Acid Ethyl Ester |
|---|---|
| Synonyms | [(3,4-Dichlorophenyl)Amino]Methanedithioic Acid Ethyl Ester; Carbanilic Acid, 3,4-Dichlorodithio-, Ethyl Ester; Ethyl 3,4-Dichlorodithiocarbanilate |
| Molecular Structure |  |
| Molecular Formula | C9H9Cl2NS2 |
| Molecular Weight | 266.20 |
| CAS Registry Number | 13037-37-1 |
| SMILES | C1=C(C(=CC=C1NC(SCC)=S)Cl)Cl |
| InChI | 1S/C9H9Cl2NS2/c1-2-14-9(13)12-6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3,(H,12,13) |
| InChIKey | AHFQVRXMYZFPHT-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dichlorophenylcarbamodithioic Acid Ethyl Ester |
