|
CAS#: 130548-10-6 Product: 8-Methoxy-3-Methyl-3,4-Dihydro-1,7,12(2H)-Tetraphenetrione No suppilers available for the product. |
| Name | 8-Methoxy-3-Methyl-3,4-Dihydro-1,7,12(2H)-Tetraphenetrione |
|---|---|
| Synonyms | 8-Methoxy |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 |
| CAS Registry Number | 130548-10-6 |
| SMILES | O=C3c2c(ccc1c2C(=O)CC(C1)C)C(=O)c4c3cccc4OC |
| InChI | 1S/C20H16O4/c1-10-8-11-6-7-13-18(16(11)14(21)9-10)20(23)12-4-3-5-15(24-2)17(12)19(13)22/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | ZUCWNLVDTXGGSU-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.246°C at 760 mmHg (Cal.) |
| Flash point | 240.156°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methoxy-3-Methyl-3,4-Dihydro-1,7,12(2H)-Tetraphenetrione |