Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (908) 359-6778 | |||
|
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | N-[(Benzyloxy)Carbonyl]-L-Histidylglycine |
|---|---|
| Synonyms | Z-HIS-GLY-OH |
| Molecular Structure | ![CAS#: 13056-37-6， N-[(Benzyloxy)Carbonyl]-L-Histidylglycine](/moreStructures/13056-37-6.gif) |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 |
| CAS Registry Number | 13056-37-6 |
| SMILES | O=C(O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)Cc2cncn2 |
| InChI | 1S/C16H18N4O5/c21-14(22)8-18-15(23)13(6-12-7-17-10-19-12)20-16(24)25-9-11-4-2-1-3-5-11/h1-5,7,10,13H,6,8-9H2,(H,17,19)(H,18,23)(H,20,24)(H,21,22)/t13-/m0/s1 |
| InChIKey | LMUKBPFKDIAQEY-ZDUSSCGKSA-N |
| Density | 1.384g/cm3 (Cal.) |
|---|---|
| Boiling point | 787.005°C at 760 mmHg (Cal.) |
| Flash point | 429.765°C (Cal.) |
| Refractive index | 1.608 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(Benzyloxy)Carbonyl]-L-Histidylglycine |