Online Database of Chemicals from Around the World
| Name | 2-(4-Chlorophenyl)-1-Hydroxyguanidine |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-1-Hydroxy-Guanidine; N-(Chlorophenyl)-N'-Hydroxyguanidine; Ph3 |
| Molecular Structure |  |
| Molecular Formula | C7H8ClN3O |
| Molecular Weight | 185.61 |
| CAS Registry Number | 130974-86-6 |
| SMILES | C1=C(N=C(NO)N)C=CC(=C1)Cl |
| InChI | 1S/C7H8ClN3O/c8-5-1-3-6(4-2-5)10-7(9)11-12/h1-4,12H,(H3,9,10,11) |
| InChIKey | JYBXKTLYOMPMQY-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.583°C at 760 mmHg (Cal.) |
| Flash point | 176.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-1-Hydroxyguanidine |
