| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Watanabe Chemical Ind., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Phenylalanine derivatives |
|---|---|
| Name | N-Carbobenzoxy-L-Phenylalanyl-L-Phenylalanine |
| Synonyms | (2S)-2-[[(2S)-1-Oxo-2-[[Oxo-(Phenylmethoxy)Methyl]Amino]-3-Phenylpropyl]Amino]-3-Phenylpropanoic Acid; (2S)-2-[[(2S)-2-(Benzyloxycarbonylamino)-3-Phenyl-Propanoyl]Amino]-3-Phenyl-Propionic Acid; 3-Phenyl-N-(3-Phenyl-N-((Phenylmethoxy)Carbonyl)-L-Alanyl)-L-Alanine |
| Molecular Structure | ![]() |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 |
| CAS Registry Number | 13122-91-3 |
| EINECS | 236-051-2 |
| SMILES | [C@@H](C(=O)O)(CC1=CC=CC=C1)NC([C@H](CC2=CC=CC=C2)NC(OCC3=CC=CC=C3)=O)=O |
| InChI | 1S/C26H26N2O5/c29-24(27-23(25(30)31)17-20-12-6-2-7-13-20)22(16-19-10-4-1-5-11-19)28-26(32)33-18-21-14-8-3-9-15-21/h1-15,22-23H,16-18H2,(H,27,29)(H,28,32)(H,30,31)/t22-,23-/m0/s1 |
| InChIKey | JNRHNGGTJOBXHL-GOTSBHOMSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Melting point | 159°C (Expl.) |
| Boiling point | 730.204°C at 760 mmHg (Cal.) |
| Flash point | 395.413°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Carbobenzoxy-L-Phenylalanyl-L-Phenylalanine |