|
CAS#: 13122-97-9 Product: N-[(Benzyloxy)Carbonyl]-L-Alanyl-L-Tyrosine No suppilers available for the product. |
| Name | N-[(Benzyloxy)Carbonyl]-L-Alanyl-L-Tyrosine |
|---|---|
| Synonyms | Z-ALA-TYR-OH |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 |
| CAS Registry Number | 13122-97-9 |
| SMILES | O=C(OCc1ccccc1)N[C@H](C(=O)N[C@H](C(=O)O)Cc2ccc(O)cc2)C |
| InChI | 1S/C20H22N2O6/c1-13(21-20(27)28-12-15-5-3-2-4-6-15)18(24)22-17(19(25)26)11-14-7-9-16(23)10-8-14/h2-10,13,17,23H,11-12H2,1H3,(H,21,27)(H,22,24)(H,25,26)/t13-,17-/m0/s1 |
| InChIKey | INPGUDNBCHNMDV-GUYCJALGSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 699.111°C at 760 mmHg (Cal.) |
| Flash point | 376.609°C (Cal.) |
| Refractive index | 1.599 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(Benzyloxy)Carbonyl]-L-Alanyl-L-Tyrosine |