|
CAS#: 131267-80-6 Product: (17beta)-N-(2-Methyl-2-Propanyl)-3-Oxoandrost-4-Ene-17-Carboxamide No suppilers available for the product. |
| Name | (17beta)-N-(2-Methyl-2-Propanyl)-3-Oxoandrost-4-Ene-17-Carboxamide |
|---|---|
| Synonyms | N-t-butyl-4-Androsten-3-one-17β-Carboxamide; N-tert-Butyl-3-oxo-4-androst-4-ene-17β-carboxamide; AIDS085956 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.56 |
| CAS Registry Number | 131267-80-6 |
| SMILES | O=C4\C=C2/[C@]([C@H]1CC[C@@]3([C@@H](C(=O)NC(C)(C)C)CC[C@H]3[C@@H]1CC2)C)(C)CC4 |
| InChI | 1S/C24H37NO2/c1-22(2,3)25-21(27)20-9-8-18-17-7-6-15-14-16(26)10-12-23(15,4)19(17)11-13-24(18,20)5/h14,17-20H,6-13H2,1-5H3,(H,25,27)/t17-,18-,19-,20+,23-,24-/m0/s1 |
| InChIKey | ROEIROHDVYUAGF-ZEQQQVMLSA-N |
| Density | 1.076g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.039°C at 760 mmHg (Cal.) |
| Flash point | 157.941°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (17beta)-N-(2-Methyl-2-Propanyl)-3-Oxoandrost-4-Ene-17-Carboxamide |