Online Database of Chemicals from Around the World
| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (978) 521-6300 | |||
 |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3,4'-Dimethylbenzophenone |
|---|---|
| Synonyms | Zinc02560075 |
| Molecular Structure |  |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 |
| CAS Registry Number | 13152-94-8 |
| SMILES | C2=C(C(C1=CC=C(C)C=C1)=O)C=CC=C2C |
| InChI | 1S/C15H14O/c1-11-6-8-13(9-7-11)15(16)14-5-3-4-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | YMDBXBBWNOELNV-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.107°C at 760 mmHg (Cal.) |
| Flash point | 153.656°C (Cal.) |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3,4'-Dimethylbenzophenone |