Online Database of Chemicals from Around the World
|
CAS#: 13181-50-5 Product: N,N-Dimethyl-N'-(4-Bromophenyl)Formamidine No suppilers available for the product. |
| Name | N,N-Dimethyl-N'-(4-Bromophenyl)Formamidine |
|---|---|
| Synonyms | N'-(4-Bromophenyl)-N,N-Dimethyl-Formamidine; N'-(4-Bromophenyl)-N,N-Dimethylformamidine; N'-(4-Bromophenyl)-N,N-Dimethyl-Methanimidamide |
| Molecular Structure |  |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.10 |
| CAS Registry Number | 13181-50-5 |
| SMILES | C1=C(N=CN(C)C)C=CC(=C1)Br |
| InChI | 1S/C9H11BrN2/c1-12(2)7-11-9-5-3-8(10)4-6-9/h3-7H,1-2H3 |
| InChIKey | OJKJZQJONGTMRZ-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.898°C at 760 mmHg (Cal.) |
| Flash point | 122.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-N'-(4-Bromophenyl)Formamidine |