Online Database of Chemicals from Around the World
|
CAS#: 13207-47-1 Product: N,1-Diphenylhydrazinecarbothioamide No suppilers available for the product. |
| Name | N,1-Diphenylhydrazinecarbothioamide |
|---|---|
| Synonyms | 2,4-Diphenyl-3-thiosemicarbazide; Hydrazinecarbothioamide, N,1-diphenyl-; N,1-Diphenylhydrazinecarbothioamide # |
| Molecular Structure |  |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.33 |
| CAS Registry Number | 13207-47-1 |
| SMILES | S=C(N(N)c1ccccc1)Nc2ccccc2 |
| InChI | 1S/C13H13N3S/c14-16(12-9-5-2-6-10-12)13(17)15-11-7-3-1-4-8-11/h1-10H,14H2,(H,15,17) |
| InChIKey | AIONMUKAPQSLHW-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.53°C at 760 mmHg (Cal.) |
| Flash point | 185.753°C (Cal.) |
| Refractive index | 1.766 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,1-Diphenylhydrazinecarbothioamide |