|
CAS#: 13207-63-1 Product: 5-Iodo-8-Quinolinol No suppilers available for the product. |
| Name | 5-Iodo-8-Quinolinol |
|---|---|
| Synonyms | 5-Iodo-8-Quinolinol; 8-Hydroxy-5-Iodoquinoline; Nsc53183 |
| Molecular Formula | C9H6INO |
| Molecular Weight | 271.06 |
| CAS Registry Number | 13207-63-1 |
| SMILES | C1=CC(=C2C(=C1I)C=CC=N2)O |
| InChI | 1S/C9H6INO/c10-7-3-4-8(12)9-6(7)2-1-5-11-9/h1-5,12H |
| InChIKey | SUQZNPQQZDQDPJ-UHFFFAOYSA-N |
| Density | 1.974g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.782°C at 760 mmHg (Cal.) |
| Flash point | 190.138°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Iodo-8-Quinolinol |