Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2,2-Trifluoro-1-(3-Trimethylsilylphenyl)Ethanone |
|---|---|
| Synonyms | Zifrosilone [Usan:Inn]; 2,2,2-Trifluoro-1-(3-(Trimethylsilyl)Phenyl)Ethanone; 2,2,2-Trifluoro-3'-(Trimethylsilyl)Acetophenone |
| Molecular Structure |  |
| Molecular Formula | C11H13F3OSi |
| Molecular Weight | 246.30 |
| CAS Registry Number | 132236-18-1 |
| SMILES | C1=C(C(C(F)(F)F)=O)C=CC=C1[Si](C)(C)C |
| InChI | 1S/C11H13F3OSi/c1-16(2,3)9-6-4-5-8(7-9)10(15)11(12,13)14/h4-7H,1-3H3 |
| InChIKey | GAPOASFZXBWUGS-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.258°C at 760 mmHg (Cal.) |
| Flash point | 83.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trifluoro-1-(3-Trimethylsilylphenyl)Ethanone |