Online Database of Chemicals from Around the World
|
CAS#: 132296-19-6 Product: 2-(3-Hydroxycyclohexyl)-5-(2-Methyl-2-Hexanyl)Phenol No suppilers available for the product. |
| Name | 2-(3-Hydroxycyclohexyl)-5-(2-Methyl-2-Hexanyl)Phenol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.44 |
| CAS Registry Number | 132296-19-6 |
| SMILES | OC1CC(CCC1)c2ccc(cc2O)C(C)(C)CCCC |
| InChI | 1S/C19H30O2/c1-4-5-11-19(2,3)15-9-10-17(18(21)13-15)14-7-6-8-16(20)12-14/h9-10,13-14,16,20-21H,4-8,11-12H2,1-3H3 |
| InChIKey | ISHOMFLIXRPGRA-UHFFFAOYSA-N |
| Density | 1.029g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.053°C at 760 mmHg (Cal.) |
| Flash point | 171.536°C (Cal.) |
| Refractive index | 1.535 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Hydroxycyclohexyl)-5-(2-Methyl-2-Hexanyl)Phenol |