Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,4-Benzenediol 1-(4-Nitrobenzoate) |
|---|---|
| Synonyms | 4-Nitrobenzoic Acid (4-Hydroxyphenyl) Ester; Nsc23422 |
| Molecular Structure |  |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.22 |
| CAS Registry Number | 13245-55-1 |
| SMILES | C1=CC(=CC=C1O)OC(=O)C2=CC=C(C=C2)[N+]([O-])=O |
| InChI | 1S/C13H9NO5/c15-11-5-7-12(8-6-11)19-13(16)9-1-3-10(4-2-9)14(17)18/h1-8,15H |
| InChIKey | OOKOBCBLUCPMQB-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.624°C at 760 mmHg (Cal.) |
| Flash point | 242.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Benzenediol 1-(4-Nitrobenzoate) |