Online Database of Chemicals from Around the World
|
CAS#: 13249-46-2 Product: Carboxymuconolactone No suppilers available for the product. |
| Name | Carboxymuconolactone |
|---|---|
| Synonyms | 2-(5-Oxo-2H-Furan-2-Yl)Acetic Acid Carboxy Ester; 2-(5-Keto-2H-Furan-2-Yl)Acetic Acid Carboxy Ester; Carboxy 2-(5-Oxo-2H-Furan-2-Yl)Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C7H6O6 |
| Molecular Weight | 186.12 |
| CAS Registry Number | 13249-46-2 |
| SMILES | C(C1OC(=O)C=C1)C(OC(=O)O)=O |
| InChI | 1S/C7H6O6/c8-5-2-1-4(12-5)3-6(9)13-7(10)11/h1-2,4H,3H2,(H,10,11) |
| InChIKey | PBUXXOVUNSLEPE-UHFFFAOYSA-N |
| Density | 1.529g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.128°C at 760 mmHg (Cal.) |
| Flash point | 194.789°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carboxymuconolactone |