Online Database of Chemicals from Around the World
|
CAS#: 132536-78-8 Product: Triptogelin A-1 No suppilers available for the product. |
| Name | Triptogelin A-1 |
|---|---|
| Synonyms | Triptogelin A-1 |
| Molecular Structure |  |
| Molecular Formula | C45H44O11 |
| Molecular Weight | 760.84 |
| CAS Registry Number | 132536-78-8 |
| SMILES | [C@@H]17C(OC4([C@]([C@@H]([C@@H]1OC(C2=CC=CC=C2)=O)OC(C3=CC=CC=C3)=O)([C@H]([C@H](C[C@H]4C)OC(C5=CC=CC=C5)=O)OC(C6=CC=CC=C6)=O)C)[C@@H]7OC(C)=O)(C)C |
| InChI | 1S/C45H44O11/c1-27-26-33(52-39(47)29-18-10-6-11-19-29)36(54-41(49)31-22-14-8-15-23-31)44(5)38(55-42(50)32-24-16-9-17-25-32)35(53-40(48)30-20-12-7-13-21-30)34-37(51-28(2)46)45(27,44)56-43(34,3)4/h6-25,27,33-38H,26H2,1-5H3/t27-,33+,34-,35-,36+,37-,38-,44+,45?/m1/s1 |
| InChIKey | KAMRIYILCXXILS-XFGNNEDSSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 790.091°C at 760 mmHg (Cal.) |
| Flash point | 315.318°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triptogelin A-1 |