Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (4S)-4-Fluoro-D-Glutamic Acid |
|---|---|
| Synonyms | (2R,4S)-2-amino-4-fluoropentanedioic acid; D-erythro-4-Fluoroglutamic acid 99.5%; DL-erythro-4-Fluoroglutamic acid 99.5% |
| Molecular Structure |  |
| Molecular Formula | C5H8FNO4 |
| Molecular Weight | 165.12 |
| CAS Registry Number | 132746-47-5 |
| SMILES | F[C@H](C(=O)O)C[C@H](C(=O)O)N |
| InChI | 1S/C5H8FNO4/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)/t2-,3+/m0/s1 |
| InChIKey | JPSHPWJJSVEEAX-STHAYSLISA-N |
| Density | 1.498g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.371°C at 760 mmHg (Cal.) |
| Flash point | 160.86°C (Cal.) |
| Refractive index | 1.492 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4S)-4-Fluoro-D-Glutamic Acid |