|
CAS#: 13277-62-8 Product: 3-Nitrobenzoyl Bromide No suppilers available for the product. |
| Name | 3-Nitrobenzoyl Bromide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H4BrNO3 |
| Molecular Weight | 230.02 |
| CAS Registry Number | 13277-62-8 |
| SMILES | O=[N+]([O-])c1cc(C(Br)=O)ccc1 |
| InChI | 1S/C7H4BrNO3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H |
| InChIKey | YPLWRVLXVBKSIU-UHFFFAOYSA-N |
| Density | 1.776g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.681°C at 760 mmHg (Cal.) |
| Flash point | 146.533°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrobenzoyl Bromide |