Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-{[4-(Aminomethoxy)Benzyl]Oxy}Aniline |
|---|---|
| Synonyms | 4-(4-aminomethoxyphenyl)methoxyaniline |
| Molecular Structure | ![CAS#: 1331-53-9， 4-{[4-(Aminomethoxy)Benzyl]Oxy}Aniline](/moreStructures/1331-53-9.gif) |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 |
| CAS Registry Number | 1331-53-9 |
| EINECS | 215-558-2 |
| SMILES | NCOc1ccc(cc1)COc2ccc(N)cc2 |
| InChI | 1S/C14H16N2O2/c15-10-18-14-5-1-11(2-6-14)9-17-13-7-3-12(16)4-8-13/h1-8H,9-10,15-16H2 |
| InChIKey | ARJNPAHQVKCTJV-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.909°C at 760 mmHg (Cal.) |
| Flash point | 248.562°C (Cal.) |
| Refractive index | 1.621 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{[4-(Aminomethoxy)Benzyl]Oxy}Aniline |