| APIChem Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Atomole Scientific Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Serine derivative |
|---|---|
| Name | Methyl N-(Diphenylmethylene)-L-Serinate |
| Synonyms | Methyl N-(Diphenylmethylene)-L-serinate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32 |
| CAS Registry Number | 133157-01-4 |
| SMILES | O=C(OC)[C@@H](/N=C(\c1ccccc1)c2ccccc2)CO |
| InChI | 1S/C17H17NO3/c1-21-17(20)15(12-19)18-16(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15,19H,12H2,1H3/t15-/m0/s1 |
| InChIKey | INDYBELMPCDQHK-HNNXBMFYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.575°C at 760 mmHg (Cal.) |
| Flash point | 207.552°C (Cal.) |
| Refractive index | 1.556 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-(Diphenylmethylene)-L-Serinate |