Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-2-Fluoro-1-Indanol |
|---|---|
| Synonyms | (1R,2R)-2-fluoro-2,3-dihydro-1H-inden-1-ol |
| Molecular Structure |  |
| Molecular Formula | C9H9FO |
| Molecular Weight | 152.17 |
| CAS Registry Number | 133413-63-5 |
| SMILES | c1ccc2c(c1)C[C@H]([C@@H]2O)F |
| InChI | 1S/C9H9FO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5H2/t8-,9-/m1/s1 |
| InChIKey | JIXFNDYGBLPPOR-RKDXNWHRSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.263°C at 760 mmHg (Cal.) |
| Flash point | 118.996°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-Fluoro-1-Indanol |