| Nantong Gruechem Pharmaceutical Co.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.gruechem.com | |||
![]() | +86 13809088763 | |||
![]() | info@gruechem.com | |||
| Chemical manufacturer since 2017 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | N-(tert-Butoxycarbonyl)-3-[4-(tert-butoxycarbonyl)piperazin-1-yl]-L-alanine |
|---|---|
| Synonyms | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H31N3O6 |
| Molecular Weight | 373.44 |
| CAS Registry Number | 1334509-91-9 |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CN1CCN(CC1)C(=O)OC(C)(C)C)C(=O)O |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.502, Calc.* |
| Boiling Point | 519.5±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 268.0±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-(tert-Butoxycarbonyl)-3-[4-(tert-butoxycarbonyl)piperazin-1-yl]-L-alanine |