Online Database of Chemicals from Around the World
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (858) 451-7400 | |||
 |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | 2-(Phenylthio)Anthraquinone |
|---|---|
| Synonyms | 2-(Phenylthio)Anthracene-9,10-Dione; 2-(Phenylthio)-9,10-Anthraquinone; Cbmicro_020784 |
| Molecular Structure |  |
| Molecular Formula | C20H12O2S |
| Molecular Weight | 316.37 |
| CAS Registry Number | 13354-40-0 |
| SMILES | C2=C(SC1=CC=CC=C1)C=CC3=C2C(=O)C4=C(C3=O)C=CC=C4 |
| InChI | 1S/C20H12O2S/c21-19-15-8-4-5-9-16(15)20(22)18-12-14(10-11-17(18)19)23-13-6-2-1-3-7-13/h1-12H |
| InChIKey | UHLJBBJJVKIIOY-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.487°C at 760 mmHg (Cal.) |
| Flash point | 236.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Phenylthio)Anthraquinone |