Online Database of Chemicals from Around the World
| Name | Fluoranthen-1-Ylmethanol |
|---|---|
| Synonyms | 1-Fluoranthenylmethanol; 1-Hydroxymethylfluoranthene; Ccris 5199 |
| Molecular Structure |  |
| Molecular Formula | C17H12O |
| Molecular Weight | 232.28 |
| CAS Registry Number | 133550-91-1 |
| SMILES | C2=CC1=CC=CC3=C1C(=C2CO)C4=CC=CC=C34 |
| InChI | 1S/C17H12O/c18-10-12-9-8-11-4-3-7-15-13-5-1-2-6-14(13)17(12)16(11)15/h1-9,18H,10H2 |
| InChIKey | LYNLFKVZHLIKRI-UHFFFAOYSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.175°C at 760 mmHg (Cal.) |
| Flash point | 207.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fluoranthen-1-Ylmethanol |
