Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,3-Trichloro-5-(3,4,5-trichlorophenyl)benzene |
|---|---|
| Synonyms | Polychlorinated Biphenyls (Pcbs); 1,1'-Biphenyl, 3,3',4,4',5,5'-Hexachloro-; 1,1'-Biphenyl, 3,3',4,4',5,5'-Hexachloro- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C12H4Cl6 |
| Molecular Weight | 360.88 |
| CAS Registry Number | 1336-36-3 |
| EINECS | 215-648-1 |
| SMILES | C1=C(C(=C(C=C1C2=CC(=C(C(=C2)Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H4Cl6/c13-7-1-5(2-8(14)11(7)17)6-3-9(15)12(18)10(16)4-6/h1-4H |
| InChIKey | ZHLICBPIXDOFFG-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.636°C at 760 mmHg (Cal.) |
| Flash point | 223.145°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Trichloro-5-(3,4,5-trichlorophenyl)benzene |