Online Database of Chemicals from Around the World
|
CAS#: 133605-28-4 Product: 2-(Bromomethyl)-1-Nitro-4-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 2-(Bromomethyl)-1-Nitro-4-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | 2-Nitro-5-(trifluoromethyl)benzyl bromide |
| Molecular Structure |  |
| Molecular Formula | C8H5BrF3NO2 |
| Molecular Weight | 284.03 |
| CAS Registry Number | 133605-28-4 |
| SMILES | BrCc1cc(ccc1N(=O)=O)C(F)(F)F |
| InChI | 1S/C8H5BrF3NO2/c9-4-5-3-6(8(10,11)12)1-2-7(5)13(14)15/h1-3H,4H2 |
| InChIKey | WJRRHFDQKYISTH-UHFFFAOYSA-N |
| Density | 1.729g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.437°C at 760 mmHg (Cal.) |
| Flash point | 120.985°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Bromomethyl)-1-Nitro-4-(Trifluoromethyl)Benzene |