Online Database of Chemicals from Around the World
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 (431) 5606-600 | |||
 |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | Ethyl 5-Bromotryptophanate |
|---|---|
| Synonyms | 5-Bromotryptophan ethyl ester |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.17 |
| CAS Registry Number | 133766-36-6 |
| SMILES | CCOC(=O)C(Cc1c[nH]c2c1cc(cc2)Br)N |
| InChI | 1S/C13H15BrN2O2/c1-2-18-13(17)11(15)5-8-7-16-12-4-3-9(14)6-10(8)12/h3-4,6-7,11,16H,2,5,15H2,1H3 |
| InChIKey | SFZGEFLYBJGMPV-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.123°C at 760 mmHg (Cal.) |
| Flash point | 224.817°C (Cal.) |
| Refractive index | 1.64 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-Bromotryptophanate |