| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | 10-Formylfolic acid |
| Synonyms | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoyl]amino]pentanedioic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H19N7O7 |
| Molecular Weight | 469.41 |
| Protein Sequence | XE |
| CAS Registry Number | 134-05-4 |
| EC Number | 801-529-7 |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)C=O |
| Solubility | 2.808e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.748, Calc.* |
| Melting point | 349.84 °C |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H317-H334 Details | ||||||||||||
| Safety Statements | P261-P272-P280-P284-P302+P352-P304+P340-P321-P333+P313-P342+P316-P362+P364-P501 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| Market Analysis Reports |
| List of Reports Available for 10-Formylfolic acid |