Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4,6-O-Ethylidene-D-Glucose |
|---|---|
| Synonyms | (2R,3R)-2,3-Dihydroxy-3-[(4R,5R)-5-Hydroxy-2-Methyl-1,3-Dioxan-4-Yl]Propionaldehyde; 4,6-O-Ethylidene-D-Glucose |
| Molecular Structure |  |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.20 |
| CAS Registry Number | 13403-24-2 |
| EINECS | 236-496-2 |
| SMILES | [C@H]1(OC(OC[C@H]1O)C)[C@H](O)[C@@H](O)C=O |
| InChI | 1S/C8H14O6/c1-4-13-3-6(11)8(14-4)7(12)5(10)2-9/h2,4-8,10-12H,3H2,1H3/t4?,5-,6+,7+,8+/m0/s1 |
| InChIKey | CYJNDOQNVXFIJC-XUQKIGAKSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.116°C at 760 mmHg (Cal.) |
| Flash point | 176.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-O-Ethylidene-D-Glucose |