Online Database of Chemicals from Around the World
|
CAS#: 13421-39-1 Product: 4-Tert-Butylphenyl Dihydrogen Phosphate No suppilers available for the product. |
| Name | 4-Tert-Butylphenyl Dihydrogen Phosphate |
|---|---|
| Synonyms | P-Tert-Butylphenyl Dihydrogen Phosphate |
| Molecular Structure |  |
| Molecular Formula | C10H15O4P |
| Molecular Weight | 230.20 |
| CAS Registry Number | 13421-39-1 |
| EINECS | 236-530-6 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1)O[P](=O)(O)O |
| InChI | 1S/C10H15O4P/c1-10(2,3)8-4-6-9(7-5-8)14-15(11,12)13/h4-7H,1-3H3,(H2,11,12,13) |
| InChIKey | BFVWABPNHXPWPS-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.642°C at 760 mmHg (Cal.) |
| Flash point | 176.749°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Tert-Butylphenyl Dihydrogen Phosphate |