Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Glutaric Acid Bisdimethylamide |
|---|---|
| Synonyms | N,N,N',N'-Tetramethylglutaramide |
| Molecular Structure |  |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 |
| CAS Registry Number | 13424-80-1 |
| EINECS | 236-543-7 |
| SMILES | C(C(N(C)C)=O)CCC(N(C)C)=O |
| InChI | 1S/C9H18N2O2/c1-10(2)8(12)6-5-7-9(13)11(3)4/h5-7H2,1-4H3 |
| InChIKey | WFXSOGZBNQWNIV-UHFFFAOYSA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.811°C at 760 mmHg (Cal.) |
| Flash point | 133.189°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glutaric Acid Bisdimethylamide |