Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (1204) 527-700 | |||
|
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 2,3-Epoxypropyl Benzoate |
|---|---|
| Synonyms | Benzoic Acid 2-Oxiranylmethyl Ester; Benzoic Acid Glycidyl Ester; Oxiranemethanol, Benzoate |
| Molecular Structure |  |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 13443-29-3 |
| EINECS | 236-583-5 |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2CO2 |
| InChI | 1S/C10H10O3/c11-10(13-7-9-6-12-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | XRQKARZTFMEBBY-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.703°C at 760 mmHg (Cal.) |
| Flash point | 108.995°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Epoxypropyl Benzoate |