Online Database of Chemicals from Around the World
|
CAS#: 13450-59-4 Product: Methyl 2-{(2-Aminophenyl)[3-(Dimethylamino)Propyl]Amino}Benzoate No suppilers available for the product. |
| Name | Methyl 2-{(2-Aminophenyl)[3-(Dimethylamino)Propyl]Amino}Benzoate |
|---|---|
| Synonyms | Methyl 2-(2-amino[3-(dimethylamino)propyl]anilino)benzoate # |
| Molecular Structure | ![CAS#: 13450-59-4， Methyl 2-{(2-Aminophenyl)[3-(Dimethylamino)Propyl]Amino}Benzoate](/moreStructures/13450-59-4.gif) |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.42 |
| CAS Registry Number | 13450-59-4 |
| SMILES | O=C(OC)c2ccccc2N(c1ccccc1N)CCCN(C)C |
| InChI | 1S/C19H25N3O2/c1-21(2)13-8-14-22(18-12-7-5-10-16(18)20)17-11-6-4-9-15(17)19(23)24-3/h4-7,9-12H,8,13-14,20H2,1-3H3 |
| InChIKey | UHHNZYAOVLIOEB-UHFFFAOYSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.492°C at 760 mmHg (Cal.) |
| Flash point | 241.974°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-{(2-Aminophenyl)[3-(Dimethylamino)Propyl]Amino}Benzoate |