Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1,2,2,3,3,4,4,5,5-Decamethyl-Cyclopentasilane |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4,5,5-Decamethyl-1,2,3,4,5-Pentasilolane; Cyclopentasilane,Decamethyl- |
| Molecular Structure |  |
| Molecular Formula | C10H30Si5 |
| Molecular Weight | 290.78 |
| CAS Registry Number | 13452-92-1 |
| SMILES | C[Si]1([Si]([Si]([Si]([Si]1(C)C)(C)C)(C)C)(C)C)C |
| InChI | 1S/C10H30Si5/c1-11(2)12(3,4)14(7,8)15(9,10)13(11,5)6/h1-10H3 |
| InChIKey | VGLVSMNWXDHPHX-UHFFFAOYSA-N |
| Density | 0.823g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.116°C at 760 mmHg (Cal.) |
| Flash point | 58.34°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,5,5-Decamethyl-Cyclopentasilane |