| LinkChem Shanghai Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.linkchem.cn | |||
![]() | +86 (21) 5895-0110 +86 13391192982 | |||
![]() | +86 (21) 2022-2982 | |||
![]() | sales@linkchem.cn | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2011 | ||||
| Name | (4-Methoxy-2-aminophenyl)-(4-aminophenyl)-amine |
|---|---|
| Synonyms | 1-N-(4-aminophenyl)-4-methoxybenzene-1,2-diamine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 |
| CAS Registry Number | 1345687-79-7 |
| SMILES | COC1=CC(=C(C=C1)NC2=CC=C(C=C2)N)N |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.696, Calc.* |
| Boiling Point | 424.6±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 210.6±27.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (4-Methoxy-2-aminophenyl)-(4-aminophenyl)-amine |