Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 7-Chlorothiokynurenic Acid |
|---|---|
| Synonyms | 7-Chloro-4-Thioxo-1H-Quinoline-2-Carboxylic Acid; 7-Cl-Thio-Kyna; 7-Cl-Thio-Kynurenate |
| Molecular Structure |  |
| Molecular Formula | C10H6ClNO2S |
| Molecular Weight | 239.68 |
| CAS Registry Number | 135025-56-8 |
| SMILES | C1=C(Cl)C=CC2=C1NC(=CC2=S)C(O)=O |
| InChI | 1S/C10H6ClNO2S/c11-5-1-2-6-7(3-5)12-8(10(13)14)4-9(6)15/h1-4H,(H,12,15)(H,13,14) |
| InChIKey | KSCOHHUVHWAXLK-UHFFFAOYSA-N |
| Density | 1.614g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.235°C at 760 mmHg (Cal.) |
| Flash point | 179.526°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chlorothiokynurenic Acid |