Online Database of Chemicals from Around the World
|
CAS#: 135161-97-6 Product: 1-Butyl-3,6,8-Trihydroxyanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1-Butyl-3,6,8-Trihydroxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 1-Butyl-3,6,8-Trihydroxy-Anthracene-9,10-Dione; 1-Butyl-3,6,8-Trihydroxy-9,10-Anthraquinone; 9,10-Anthracenedione, 1-Butyl-3,6,8-Trihydroxy- |
| Molecular Structure |  |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 |
| CAS Registry Number | 135161-97-6 |
| SMILES | C1=C(O)C=C(C2=C1C(=O)C3=C(C2=O)C(=CC(=C3)O)O)CCCC |
| InChI | 1S/C18H16O5/c1-2-3-4-9-5-10(19)6-12-15(9)18(23)16-13(17(12)22)7-11(20)8-14(16)21/h5-8,19-21H,2-4H2,1H3 |
| InChIKey | PPZYTBDLRLLDOP-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.592°C at 760 mmHg (Cal.) |
| Flash point | 324.409°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Butyl-3,6,8-Trihydroxyanthracene-9,10-Dione |