Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7-Ethoxy-4,5-Dihydro-2H-Pyrazolo[3,4-f]Quinoline |
|---|---|
| Synonyms | 7-ethoxy-4,5-dihydro-1H-pyrazolo[3,4-f]quinoline |
| Molecular Structure | ![CAS#: 135219-96-4， 7-Ethoxy-4,5-Dihydro-2H-Pyrazolo[3,4-f]Quinoline](/moreStructures/135219-96-4.gif) |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.25 |
| CAS Registry Number | 135219-96-4 |
| SMILES | CCOc1ccc-2c(n1)CCc3c2n[nH]c3 |
| InChI | 1S/C12H13N3O/c1-2-16-11-6-4-9-10(14-11)5-3-8-7-13-15-12(8)9/h4,6-7H,2-3,5H2,1H3,(H,13,15) |
| InChIKey | LNGFYRVTUSYUPZ-UHFFFAOYSA-N |
| Density | 1.256g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.182°C at 760 mmHg (Cal.) |
| Flash point | 153.74°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Ethoxy-4,5-Dihydro-2H-Pyrazolo[3,4-f]Quinoline |