| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | N,5-diphenyl-1,3-oxazol-2-amine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 |
| CAS Registry Number | 135307-33-4 |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)NC3=CC=CC=C3 |
| Solubility | 13.3 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.637, Calc.* |
| Melting point | 137.09 °C |
| Boiling Point | 375.86 °C, 403.9±38.0 °C (760 mmHg), Calc.* |
| Flash Point | 198.0±26.8 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N,5-diphenyl-1,3-oxazol-2-amine |