Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-2-Formylcyclopentyl Thiocyanate |
|---|---|
| Synonyms | (1R,2R)-2-thiocyanatocyclopentanecarbaldehyde |
| Molecular Structure |  |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 |
| CAS Registry Number | 135386-92-4 |
| SMILES | C1C[C@@H]([C@@H](C1)SC#N)C=O |
| InChI | 1S/C7H9NOS/c8-5-10-7-3-1-2-6(7)4-9/h4,6-7H,1-3H2/t6-,7-/m1/s1 |
| InChIKey | OPFQSNFPCBSSKH-RNFRBKRXSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.15°C at 760 mmHg (Cal.) |
| Flash point | 125.65°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-Formylcyclopentyl Thiocyanate |