Online Database of Chemicals from Around the World
| Name | Butyl 2-(2,4,5-Trichlorophenoxy)Propionate |
|---|---|
| Synonyms | 2-(2,4,5-Trichlorophenoxy)Propanoic Acid Butyl Ester; 2-(2,4,5-Trichlorophenoxy)Propionic Acid Butyl Ester; Butyl 2-(2,4,5-Trichlorophenoxy)Propionate |
| Molecular Structure |  |
| Molecular Formula | C13H15Cl3O3 |
| Molecular Weight | 325.62 |
| CAS Registry Number | 13557-98-7 |
| EINECS | 236-943-1 |
| SMILES | C1=C(OC(C(OCCCC)=O)C)C(=CC(=C1Cl)Cl)Cl |
| InChI | 1S/C13H15Cl3O3/c1-3-4-5-18-13(17)8(2)19-12-7-10(15)9(14)6-11(12)16/h6-8H,3-5H2,1-2H3 |
| InChIKey | VPXVRVAKKVBOLA-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.413°C at 760 mmHg (Cal.) |
| Flash point | 140.821°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butyl 2-(2,4,5-Trichlorophenoxy)Propionate |
