Online Database of Chemicals from Around the World
|
CAS#: 136051-65-5 Product: 3'-Hydroxy-5,5'-Dimethoxy-3,4-Methylenedioxybiphenyl No suppilers available for the product. |
| Name | 3'-Hydroxy-5,5'-Dimethoxy-3,4-Methylenedioxybiphenyl |
|---|---|
| Synonyms | 3'-Hdmdb; 3'-Hydroxy-5,5'-Dimethoxy-3,4-Methylenedioxybiphenyl; Phenol, 3-Methoxy-5-(7-Methoxy-1,3-Benzodioxol-5-Yl)- |
| Molecular Structure |  |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 |
| CAS Registry Number | 136051-65-5 |
| SMILES | C1=C(C=C(C2=C1OCO2)OC)C3=C(C=C(C=C3)O)OC |
| InChI | 1S/C15H14O5/c1-17-12-7-10(16)3-4-11(12)9-5-13(18-2)15-14(6-9)19-8-20-15/h3-7,16H,8H2,1-2H3 |
| InChIKey | AMVMFXQRVJFOEA-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.022°C at 760 mmHg (Cal.) |
| Flash point | 195.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3'-Hydroxy-5,5'-Dimethoxy-3,4-Methylenedioxybiphenyl |