Online Database of Chemicals from Around the World
|
CAS#: 13626-55-6 Product: (4R)-1-Methyl-4-Propyl-L-Prolinamide No suppilers available for the product. |
| Name | (4R)-1-Methyl-4-Propyl-L-Prolinamide |
|---|---|
| Synonyms | (2S,4R)-1-methyl-4-propylpyrrolidine-2-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.25 |
| CAS Registry Number | 13626-55-6 |
| SMILES | CCC[C@@H]1C[C@H](N(C1)C)C(=O)N |
| InChI | 1S/C9H18N2O/c1-3-4-7-5-8(9(10)12)11(2)6-7/h7-8H,3-6H2,1-2H3,(H2,10,12)/t7-,8+/m1/s1 |
| InChIKey | XGRUMIVSCDLWCM-SFYZADRCSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.084°C at 760 mmHg (Cal.) |
| Flash point | 136.496°C (Cal.) |
| Refractive index | 1.478 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4R)-1-Methyl-4-Propyl-L-Prolinamide |