Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Analytical chemistry >> Standard >> Spectrometric standard |
|---|---|
| Name | 2,2,4-Trimethyl-2H-Imidazole 1-Oxide |
| Synonyms | 2,2,4-Trimethyl-2H-imidazole 1-oxide; 2,2,4-Trimethyl-2h-imidazole-1-oxide; TMIO |
| Molecular Structure |  |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 |
| CAS Registry Number | 136440-22-7 |
| SMILES | CC1=NC([N+](=C1)[O-])(C)C |
| InChI | 1S/C6H10N2O/c1-5-4-8(9)6(2,3)7-5/h4H,1-3H3 |
| InChIKey | CNIGTNPXWSLRPH-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.9±23.0°C at 760 mmHg (Cal.) |
| Flash point | 72.3±22.6°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4-Trimethyl-2H-Imidazole 1-Oxide |