Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5,6-Dimethyl-2-Vinyl-1H-Benzimidazole |
|---|---|
| Synonyms | 5,6-dimethyl-2-vinyl-1H-benzo[d]imidazole |
| Molecular Structure |  |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 |
| CAS Registry Number | 136616-63-2 |
| SMILES | Cc1cc2c(cc1C)nc([nH]2)C=C |
| InChI | 1S/C11H12N2/c1-4-11-12-9-5-7(2)8(3)6-10(9)13-11/h4-6H,1H2,2-3H3,(H,12,13) |
| InChIKey | ZBROKEOFSJLGFN-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.793°C at 760 mmHg (Cal.) |
| Flash point | 181.862°C (Cal.) |
| Refractive index | 1.667 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethyl-2-Vinyl-1H-Benzimidazole |