Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 9H-Purine-6,9-Diamine |
|---|---|
| Synonyms | 9-aminoadenine; 9H-Purine, 6,9-diamino-; NSC76924 |
| Molecular Structure |  |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 150.14 |
| CAS Registry Number | 137062-87-4 |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)N)N |
| InChI | 1S/C5H6N6/c6-4-3-5(9-1-8-4)11(7)2-10-3/h1-2H,7H2,(H2,6,8,9) |
| InChIKey | PMYVWIREDVGFIM-UHFFFAOYSA-N |
| Density | 2.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.6±48.0°C at 760 mmHg (Cal.) |
| Flash point | 243.2±29.6°C (Cal.) |
| Refractive index | 2.009 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Purine-6,9-Diamine |