Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(3-Phosphono-2-Propen-1-Yl)-2-Piperazinecarboxylicacid |
|---|---|
| Synonyms | 4-[(E)-3-Phosphonoprop-2-Enyl]-2-Piperazinecarboxylic Acid; 2-Piperazinecarboxylic Acid, 4-(3-Phosphono-2-Propenyl)-; 3-(2-Carboxypiperazine-4-Yl)-1-Propenyl-1-Phosphonic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H15N2O5P |
| Molecular Weight | 250.19 |
| CAS Registry Number | 137424-80-7 |
| SMILES | C(N1CC(NCC1)C(O)=O)\C=C\[P](O)(O)=O |
| InChI | 1S/C8H15N2O5P/c11-8(12)7-6-10(4-2-9-7)3-1-5-16(13,14)15/h1,5,7,9H,2-4,6H2,(H,11,12)(H2,13,14,15)/b5-1+ |
| InChIKey | VZXMZMJSGLFKQI-ORCRQEGFSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.629°C at 760 mmHg (Cal.) |
| Flash point | 289.835°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Phosphono-2-Propen-1-Yl)-2-Piperazinecarboxylicacid |