Online Database of Chemicals from Around the World
|
CAS#: 137765-82-3 Product: 2-Butyllysergamide No suppilers available for the product. |
| Name | 2-Butyllysergamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 |
| CAS Registry Number | 137765-82-3 |
| SMILES | [C@@H]34CC1=C([NH]C2=CC=CC(=C12)C3=C[C@@H](C(=O)N)CN4C)CCCC |
| InChI | 1S/C20H25N3O/c1-3-4-7-16-15-10-18-14(9-12(20(21)24)11-23(18)2)13-6-5-8-17(22-16)19(13)15/h5-6,8-9,12,18,22H,3-4,7,10-11H2,1-2H3,(H2,21,24)/t12-,18-/m1/s1 |
| InChIKey | WPUBLQOZLSDKAF-KZULUSFZSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 582.706°C at 760 mmHg (Cal.) |
| Flash point | 306.21°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Butyllysergamide |