Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3,3'-[1,4-Phenylenebis(Methyleneoxy)]Dibenzaldehyde |
|---|---|
| Synonyms | 1,4-bis(3-formylphenoxy)xylene; ZINC07263307 |
| Molecular Structure | ![CAS#: 138117-09-6， 3,3'-[1,4-Phenylenebis(Methyleneoxy)]Dibenzaldehyde](/moreStructures/138117-09-6.gif) |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 |
| CAS Registry Number | 138117-09-6 |
| SMILES | O=Cc3cc(OCc1ccc(cc1)COc2cc(ccc2)C=O)ccc3 |
| InChI | 1S/C22H18O4/c23-13-19-3-1-5-21(11-19)25-15-17-7-9-18(10-8-17)16-26-22-6-2-4-20(12-22)14-24/h1-14H,15-16H2 |
| InChIKey | HBYRZQGJAYFCNP-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.719°C at 760 mmHg (Cal.) |
| Flash point | 241.646°C (Cal.) |
| Refractive index | 1.643 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-[1,4-Phenylenebis(Methyleneoxy)]Dibenzaldehyde |